CAS 1150271-15-0

N-(2-Bromo-4-nitrophenyl)benzenemethanamine

Description:

N-(2-Bromo-4-nitrophenyl)benzenemethanamine is an organic compound characterized by its complex structure, which includes a benzene ring, an amine group, and substituents such as a bromo and a nitro group. The presence of the bromo group typically imparts a degree of reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity and stability. This compound is likely to be a solid at room temperature, exhibiting moderate solubility in organic solvents due to its aromatic nature. Its potential applications may span across fields such as pharmaceuticals, agrochemicals, or materials science, where it could serve as an intermediate in the synthesis of more complex molecules. Safety considerations should be taken into account, as both bromo and nitro groups can pose health risks, necessitating proper handling and disposal protocols. Overall, N-(2-Bromo-4-nitrophenyl)benzenemethanamine represents a versatile compound with significant implications in organic synthesis.

Formula: C₁₃H₁₁BrN₂O₂

InChI: InChI=1S/C13H11BrN2O2/c14-12-8-11(16(17)18)6-7-13(12)15-9-10-4-2-1-3-5-10/h1-8,15H,9H2

InChI key: InChIKey=KFZNBRDIUGUIKO-UHFFFAOYSA-N

SMILES: N(CC1=CC=CC=C1)C2=C(Br)C=C(N(=O)=O)C=C2

Synonyms:

• Benzenemethanamine, N-(2-bromo-4-nitrophenyl)-
• N-(2-Bromo-4-nitrophenyl)benzenemethanamine
• N-Benzyl-2-bromo-4-nitroaniline

N-Benzyl 2-bromo-4-nitroaniline

CAS: 1150271-15-0

Formula: C₁₃H₁₁BrN₂O₂

Molecular weight: 307.1426

Ref: IN-DA000FP9