CAS 1150271-16-1
:N-(2-Bromo-4-nitrophenyl)-4-methoxybenzenemethanamine
Description:
N-(2-Bromo-4-nitrophenyl)-4-methoxybenzenemethanamine is an organic compound characterized by its complex structure, which includes a bromine atom, a nitro group, and a methoxy group attached to a phenyl ring. This compound belongs to the class of aromatic amines, which are known for their diverse applications in pharmaceuticals, agrochemicals, and dyes. The presence of the nitro group typically imparts significant reactivity, making it a potential candidate for further chemical transformations. The methoxy group can influence the compound's solubility and electronic properties, affecting its interaction with biological systems. Additionally, the bromine substituent can serve as a useful handle for further functionalization. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, safety and handling precautions should be observed due to the potential toxicity associated with aromatic amines and halogenated compounds. As with any chemical substance, thorough characterization and understanding of its properties are essential for its safe and effective use.
Formula:C14H13BrN2O3
InChI:InChI=1S/C14H13BrN2O3/c1-20-12-5-2-10(3-6-12)9-16-14-7-4-11(17(18)19)8-13(14)15/h2-8,16H,9H2,1H3
InChI key:InChIKey=BMWOBECNFSIFRM-UHFFFAOYSA-N
SMILES:N(CC1=CC=C(OC)C=C1)C2=C(Br)C=C(N(=O)=O)C=C2
Synonyms:- Benzenemethanamine, N-(2-bromo-4-nitrophenyl)-4-methoxy-
- N-(2-Bromo-4-nitrophenyl)-4-methoxybenzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
