CAS 1150271-18-3

2-Bromo-N,N-diethyl-4-nitrobenzenamine

Description:

2-Bromo-N,N-diethyl-4-nitrobenzenamine is an organic compound characterized by its aromatic structure, which includes a bromine atom and a nitro group attached to a benzene ring. The presence of the amino group (-NH2) indicates that it is an amine, specifically a substituted aniline, where two ethyl groups are attached to the nitrogen atom, enhancing its solubility in organic solvents. The nitro group (-NO2) is a strong electron-withdrawing group, which can influence the compound's reactivity and stability. This compound is likely to exhibit moderate to high polarity due to the presence of both the nitro and amino functional groups. It may participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic reactions, due to the functional groups present. Additionally, the bromine substituent can serve as a site for further chemical modifications. Safety data should be consulted, as compounds with bromine and nitro groups can pose health risks and environmental concerns.

Formula: C₁₀H₁₃BrN₂O₂

InChI: InChI=1S/C10H13BrN2O2/c1-3-12(4-2)10-6-5-8(13(14)15)7-9(10)11/h5-7H,3-4H2,1-2H3

InChI key: InChIKey=PCXIHLGUPLRWQI-UHFFFAOYSA-N

SMILES: N(CC)(CC)C1=C(Br)C=C(N(=O)=O)C=C1

Synonyms:

• Benzenamine, 2-bromo-N,N-diethyl-4-nitro-
• 2-Bromo-N,N-diethyl-4-nitrobenzenamine
• N,N-Diethyl 2-bromo-4-nitroaniline
• 2-Bromo-N,N-diethyl-4-nitroaniline

N,N-Diethyl 2-bromo-4-nitroaniline

CAS: 1150271-18-3

Formula: C₁₀H₁₃BrN₂O₂

Molecular weight: 273.1264

Ref: IN-DA000FP7