CAS 1150271-19-4
:1,3-Dichloro-6-ethylisoquinoline
Description:
1,3-Dichloro-6-ethylisoquinoline is a chemical compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. The presence of two chlorine atoms at the 1 and 3 positions, along with an ethyl group at the 6 position, contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the solvent's polarity. Its chlorinated nature suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as halogenated compounds often display enhanced biological activity. Additionally, the presence of the ethyl group can influence the compound's lipophilicity and overall pharmacokinetic profile. Safety data should be consulted, as chlorinated compounds can pose environmental and health risks. Overall, 1,3-Dichloro-6-ethylisoquinoline is of interest in various fields, including organic synthesis and drug development, due to its structural features and potential reactivity.
Formula:C11H9Cl2N
InChI:InChI=1S/C11H9Cl2N/c1-2-7-3-4-9-8(5-7)6-10(12)14-11(9)13/h3-6H,2H2,1H3
InChI key:InChIKey=ULIDIEBBNZJOLG-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(CC)C=C2)C=C(Cl)N1
Synonyms:- 1,3-Dichloro-6-ethylisoquinoline
- Isoquinoline, 1,3-dichloro-6-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
