CymitQuimica logo

CAS 1150271-21-8

:

2-(4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)-3-chloropyridine

Description:
2-(4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)-3-chloropyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with both a chlorine atom and a pyrazole moiety. The presence of the bromine and methyl groups on the pyrazole contributes to its unique reactivity and potential biological activity. This compound is typically used in medicinal chemistry and may exhibit properties that make it useful in the development of pharmaceuticals or agrochemicals. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of halogens (bromine and chlorine) often enhances the compound's reactivity, making it a candidate for further functionalization. Additionally, the pyrazole ring is known for its diverse biological activities, which may include anti-inflammatory or antimicrobial properties. As with many organic compounds, safety and handling precautions should be observed, as the halogenated nature of the compound may pose environmental and health risks.
Formula:C10H9BrClN3
InChI:InChI=1S/C10H9BrClN3/c1-6-9(11)7(2)15(14-6)10-8(12)4-3-5-13-10/h3-5H,1-2H3
InChI key:InChIKey=NQBZZGUNOMEMSG-UHFFFAOYSA-N
SMILES:CC=1N(N=C(C)C1Br)C2=C(Cl)C=CC=N2
Synonyms:
  • Pyridine, 2-(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)-3-chloro-
  • 2-(4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)-3-chloropyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.