CAS 1150271-31-0

1,3-Dibromo-2-methyl-5-[(trifluoromethyl)sulfonyl]benzene

Description:

1,3-Dibromo-2-methyl-5-[(trifluoromethyl)sulfonyl]benzene is an organic compound characterized by its complex structure, which includes bromine and trifluoromethyl groups. This compound features a benzene ring substituted at the 1 and 3 positions with bromine atoms, at the 2 position with a methyl group, and at the 5 position with a trifluoromethylsulfonyl group. The presence of the bromine atoms contributes to its reactivity, making it useful in various chemical syntheses and applications. The trifluoromethylsulfonyl group enhances its polarity and solubility in polar solvents, which can influence its behavior in chemical reactions. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the trifluoromethyl group. Its potential applications could span across fields such as pharmaceuticals, agrochemicals, and materials science, where such functionalized aromatic compounds are often utilized. Safety and handling precautions should be observed due to the presence of bromine and the potential toxicity associated with sulfonyl compounds.

Formula: C₈H₅Br₂F₃O₂S

InChI: InChI=1S/C8H5Br2F3O2S/c1-4-6(9)2-5(3-7(4)10)16(14,15)8(11,12)13/h2-3H,1H3

InChI key: InChIKey=QDGQQIQWVGDVAJ-UHFFFAOYSA-N

SMILES: S(C(F)(F)F)(=O)(=O)C1=CC(Br)=C(C)C(Br)=C1

Synonyms:

• 1,3-Dibromo-2-methyl-5-[(trifluoromethyl)sulfonyl]benzene
• Benzene, 1,3-dibromo-2-methyl-5-[(trifluoromethyl)sulfonyl]-

2,6-Dibromo-4-(trifluoromethylsulfonyl)toluene

CAS: 1150271-31-0

Formula: C₈H₅Br₂F₃O₂S

Molecular weight: 381.9923

Ref: IN-DA000FQ9