CAS 1150271-44-5: 1,3-Dihydro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indol-2-one

Description:1,3-Dihydro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indol-2-one is a chemical compound characterized by its unique structure, which includes an indole core fused with a dioxaborolane moiety. This compound features a bicyclic indole structure, which is known for its biological activity and potential pharmaceutical applications. The presence of the dioxaborolane group enhances its reactivity and solubility, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The tetramethyl substituents contribute to its steric bulk, influencing its interactions with other molecules. Additionally, the compound may exhibit interesting electronic properties due to the conjugated system within the indole structure. Its specific applications and reactivity can be further explored in the context of drug development and material science, where boron-containing compounds are often utilized for their unique properties. Overall, this compound represents a fascinating intersection of organic chemistry and potential therapeutic utility.

Formula:C₁₄H₁₈BNO₃

InChI:InChI=1S/C14H18BNO3/c1-13(2)14(3,4)19-15(18-13)10-6-5-7-11-9(10)8-12(17)16-11/h5-7H,8H2,1-4H3,(H,16,17)

InChI key:InChIKey=LDDMKYKRLRAKPL-UHFFFAOYSA-N

SMILES:O=C1NC2=CC=CC(B3OC(C)(C)C(O3)(C)C)=C2C1

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2H-Indol-2-one, 1,3-dihydro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- REF: IN-DA000FQ1CAS: 1150271-44-5	95%	To inquire	Mon 03 Mar 25
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)indolin-2-one REF: 10-F220573CAS: 1150271-44-5	95.0%	53.00 €~691.00 €	Thu 06 Mar 25
Oxindole-4-boronic acid, pinacol ester REF: 54-OR361514CAS: 1150271-44-5	95+%	112.00 €~992.00 €	Mon 10 Mar 25
Oxindole-4-boronic acid, pinacol ester REF: 3D-FO160105CAS: 1150271-44-5	Min. 95%	172.00 €~1,252.00 €	Mon 28 Apr 25