CAS 115035-46-6
:gly-pro 7-amido-4-methylcoumarin*hydrobromide
Description:
Gly-Pro 7-amido-4-methylcoumarin hydrobromide is a synthetic compound that belongs to the class of coumarin derivatives, which are known for their fluorescent properties and applications in biochemical assays. This compound features a glycine-proline dipeptide linked to a 7-amido-4-methylcoumarin moiety, which enhances its solubility and reactivity. The hydrobromide salt form indicates that it is stabilized by hydrobromic acid, making it more soluble in aqueous solutions. Gly-Pro 7-amido-4-methylcoumarin is often utilized as a substrate in enzymatic assays, particularly for studying proteases, due to its ability to release a fluorescent signal upon cleavage. Its fluorescence properties allow for sensitive detection and quantification in various biological and chemical applications. Additionally, the compound's structure contributes to its stability and reactivity, making it a valuable tool in research settings focused on peptide interactions and enzyme kinetics. Overall, this compound exemplifies the intersection of organic chemistry and biochemistry, facilitating advancements in molecular biology and analytical techniques.
Formula:C17H20BrN3O4
InChI:InChI=1/C17H19N3O4.BrH/c1-10-7-16(22)24-14-8-11(4-5-12(10)14)19-17(23)13-3-2-6-20(13)15(21)9-18;/h4-5,7-8,13H,2-3,6,9,18H2,1H3,(H,19,23);1H
SMILES:Cc1cc(=O)oc2cc(ccc12)N=C(C1CCCN1C(=O)CN)O.Br
Synonyms:- H-Gly-Pro-Amc Hbr
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
H-Gly-Pro-AMC · HBr
CAS:Highly sensitive substrate for dipeptidyl aminopeptidase IV (DPP IV, X-prolyldipeptidyl aminopeptidase).Formula:C17H19N3O4·HBrPurity:> 99%Color and Shape:WhiteMolecular weight:410.27L-Prolinamide, glycyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-, monohydrobromide (9CI)
CAS:Formula:C17H20BrN3O4Purity:97%Color and Shape:SolidMolecular weight:410.2624Glycyl-L-proline 7-amido-4-methylcoumarin hydrobromide
CAS:Glycyl-L-proline 7-amido-4-methylcoumarin hydrobromideColor and Shape:White To Off White PowderMolecular weight:410.26g/molGly-Pro-AMC hydrobromide
CAS:<p>Gly-Pro-AMC hydrobromide (Gly-Pro-AMC HCl) is a specific fluorescent dye used in cytofluorescence assays to detect Dipeptidyl peptidase IV (DPP-IV) activity.</p>Formula:C17H20BrN3O4Purity:97.88%Color and Shape:SolidMolecular weight:410.26Glycyl-L-proline 7-amido-4-methylcoumarin hydrobromide
CAS:<p>Fluorogenic substrate for dipeptidylaminpeptidase IV and prolyl endopeptidase. Yields a blue fluorescent solution upon cleavage.</p>Formula:C17H20BrN3O4Purity:Min. 98 Area-%Molecular weight:410.28 g/molGlycyl-L-Proline-7-Amido-4-Methylcoumarin Hydrobromide Salt extrapure, 98%
CAS:Formula:C17H19N3O4·HBrPurity:min. 98%Color and Shape:White to light yellow to orange, Powder, ClearMolecular weight:410.27GP-AMC, Fluorogenic Substrate
CAS:Controlled ProductFormula:C17H19N3O4·HBrColor and Shape:NeatMolecular weight:410.262







