CAS 115044-40-1
:3,8-Dimethyl-2-nitro-3H-imidazo[4,5-F]quinoxaline
Description:
3,8-Dimethyl-2-nitro-3H-imidazo[4,5-F]quinoxaline is a heterocyclic compound characterized by its fused imidazole and quinoxaline rings, which contribute to its unique chemical properties. This compound features two methyl groups at the 3 and 8 positions and a nitro group at the 2 position, influencing its reactivity and potential biological activity. The presence of the nitro group typically enhances the compound's electron-withdrawing characteristics, which can affect its interaction with biological targets. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural complexity and the presence of multiple functional groups. The compound's solubility, stability, and reactivity can vary based on the solvent and environmental conditions, making it a subject of interest in both synthetic and analytical chemistry. Additionally, its unique structure may confer specific properties that could be exploited in various chemical reactions or biological assays.
Formula:C11H9N5O2
InChI:InChI=1/C11H9N5O2/c1-6-5-12-7-3-4-8-10(9(7)13-6)14-11(15(8)2)16(17)18/h3-5H,1-2H3
SMILES:Cc1cnc2ccc3c(c2n1)nc(n3C)N(=O)=O
Synonyms:- 3H-Imidazo(4,5-f)quinoxaline, 3,8-dimethyl-2-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3H-Imidazo[4,5-f]quinoxaline, 3,8-dimethyl-2-nitro-
CAS:Formula:C11H9N5O2Color and Shape:SolidMolecular weight:243.2215
