CAS 115044-76-3
:Adenosine, 2-bromo-3′-deoxy-
Description:
Adenosine, 2-bromo-3′-deoxy- is a modified nucleoside that features a bromine atom at the 2-position of the ribose sugar and lacks a hydroxyl group at the 3′ position, which distinguishes it from standard adenosine. This compound is characterized by its structural components, including a purine base (adenine) linked to a ribose sugar. The presence of the bromine atom can influence its biochemical properties, potentially affecting its interaction with enzymes and receptors. As a deoxynucleoside, it may participate in various biochemical pathways, including those related to nucleic acid synthesis and cellular signaling. The modification at the 3′ position may also impact its stability and reactivity compared to unmodified nucleosides. This compound is of interest in biochemical research and pharmaceutical applications, particularly in the study of nucleoside analogs and their effects on cellular processes. Its CAS number, 115044-76-3, allows for precise identification in chemical databases and literature.
Formula:C10H12BrN5O3
InChI:InChI=1S/C10H12BrN5O3/c11-10-14-7(12)6-8(15-10)16(3-13-6)9-5(18)1-4(2-17)19-9/h3-5,9,17-18H,1-2H2,(H2,12,14,15)/t4-,5+,9+/m0/s1
InChI key:InChIKey=MOFDAKHUBHRTST-OBXARNEKSA-N
SMILES:O[C@H]1[C@H](N2C=3C(N=C2)=C(N)N=C(Br)N3)O[C@H](CO)C1
Synonyms:- 3′-Deoxy-2-bromoadenosine
- Adenosine, 2-bromo-3′-deoxy-
- 2-Bromo-3′-deoxyadenosine
- NQZ-178
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
