CAS 115044-87-6
:2-(2,2,3,3-tetrafluoropropoxy)-1,3,2-dioxaphospholane
Description:
2-(2,2,3,3-tetrafluoropropoxy)-1,3,2-dioxaphospholane is a chemical compound characterized by its unique structure, which includes a dioxaphospholane ring and a tetrafluoropropoxy substituent. This compound features a phosphorus atom bonded to oxygen atoms, contributing to its potential applications in various fields, including materials science and organophosphorus chemistry. The presence of fluorinated groups enhances its thermal stability and hydrophobic properties, making it suitable for use in specialty coatings and as a potential intermediate in the synthesis of more complex organophosphorus compounds. Additionally, the dioxaphospholane structure may impart interesting reactivity patterns, particularly in nucleophilic substitution reactions. Its specific physical and chemical properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the overall molecular weight. As with many organophosphorus compounds, safety and handling precautions are essential due to potential toxicity and environmental impact. Further research may explore its applications in pharmaceuticals, agrochemicals, or as a functional material in advanced technologies.
Formula:C5H7F4O3P
InChI:InChI=1/C5H7F4O3P/c6-4(7)5(8,9)3-12-13-10-1-2-11-13/h4H,1-3H2
SMILES:C1COP(O1)OCC(C(F)F)(F)F
Synonyms:- 1,3,2-Dioxaphospholidine, 2-(2,2,3,3-tetrafluoropropoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3,2-Dioxaphospholane, 2-(2,2,3,3-tetrafluoropropoxy)-
CAS:Formula:C5H7F4O3PMolecular weight:222.0747
