CAS 1150542-46-3
:B-[2-[(Phenylmethyl)amino]-4-pyridinyl]boronic acid
Description:
B-[2-[(Phenylmethyl)amino]-4-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a pyridine ring substituted with a phenylmethylamino group, contributing to its potential biological activity and selectivity in various chemical reactions. The boronic acid moiety is significant in medicinal chemistry, particularly in the development of inhibitors for proteases and other enzymes, as well as in the synthesis of complex organic molecules through Suzuki coupling reactions. Its solubility in polar solvents and stability under ambient conditions make it a versatile reagent in organic synthesis. Additionally, the presence of the pyridine and phenyl groups may influence its electronic properties and interactions with biological targets, making it a subject of interest in pharmaceutical research. Overall, this compound exemplifies the diverse applications of boronic acids in both synthetic and medicinal chemistry.
Formula:C12H13BN2O2
InChI:InChI=1S/C12H13BN2O2/c16-13(17)11-6-7-14-12(8-11)15-9-10-4-2-1-3-5-10/h1-8,16-17H,9H2,(H,14,15)
InChI key:InChIKey=ZSHPBNLAZXAGDN-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)C2=CC(B(O)O)=CC=N2
Synonyms:- B-[2-[(Phenylmethyl)amino]-4-pyridinyl]boronic acid
- 2-(Benzylamino)pyridin-4-ylboronic acid
- Boronic acid, B-[2-[(phenylmethyl)amino]-4-pyridinyl]-
- [2-(Benzylamino)pyridin-4-yl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
