CAS 115055-85-1
:4-BROMOBENZYLZINC BROMIDE
Description:
4-Bromobenzylzinc bromide is an organozinc compound characterized by its zinc-bromine bond and the presence of a bromobenzyl group. It typically appears as a colorless to light yellow solution and is known for its reactivity in organic synthesis, particularly in cross-coupling reactions such as the Suzuki-Miyaura reaction. This compound serves as a nucleophile, allowing for the formation of carbon-carbon bonds when reacted with electrophiles. The presence of the bromine atom enhances its reactivity, making it a valuable intermediate in the synthesis of various organic compounds, including pharmaceuticals and agrochemicals. 4-Bromobenzylzinc bromide is sensitive to moisture and air, necessitating careful handling under inert atmospheres to prevent decomposition. Its applications extend to the development of complex molecular architectures, showcasing its utility in modern synthetic chemistry. As with many organometallic compounds, safety precautions are essential due to potential toxicity and reactivity.
Formula:C7H6Br2Zn
InChI:InChI=1/C7H6Br.BrH.Zn/c1-6-2-4-7(8)5-3-6;;/h2-5H,1H2;1H;/q-1;;+2/p-1/rC7H6Br.BrZn/c1-6-2-4-7(8)5-3-6;1-2/h2-5H,1H2;/q-1;+1
SMILES:C=C1C=C[C-](C=C1)Br.Br.[Zn]
Synonyms:- 4-Bromobenzylzinc Bromide, 0.5M Solution In Tetrahydrofuran
- 4-Bromobenzylzinc Bromide Solution
- Bromozinc(1+) (4-Bromophenyl)Methanide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Bromobenzylzinc bromide, 0.5M in THF, packaged under Argon in resealable ChemSeal™ bottles
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H6Br2ZnColor and Shape:LiquidMolecular weight:315.31

