CymitQuimica logo

CAS 1150560-59-0

:

5-(2-Fluoro-3-methoxyphenyl)-1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-6-methyl-2,4(1H,3H)-pyrimidinedione

Description:
The chemical substance known as 5-(2-Fluoro-3-methoxyphenyl)-1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-6-methyl-2,4(1H,3H)-pyrimidinedione, with the CAS number 1150560-59-0, is a pyrimidinedione derivative characterized by its complex molecular structure. This compound features multiple functional groups, including fluorine and methoxy substituents, which contribute to its unique chemical properties and potential biological activity. The presence of fluorine atoms often enhances lipophilicity and metabolic stability, making such compounds of interest in medicinal chemistry. The methoxy group can influence solubility and reactivity, while the pyrimidinedione core is known for its role in various biological processes. This substance may exhibit specific pharmacological activities, potentially making it a candidate for drug development. Its synthesis and characterization would typically involve advanced organic chemistry techniques, and its behavior in biological systems would be assessed through various assays to determine efficacy and safety profiles. Overall, this compound represents a class of molecules that could have significant implications in pharmaceutical research.
Formula:C20H15F5N2O3
InChI:InChI=1S/C20H15F5N2O3/c1-10-16(11-5-3-8-15(30-2)17(11)22)18(28)26-19(29)27(10)9-12-13(20(23,24)25)6-4-7-14(12)21/h3-8H,9H2,1-2H3,(H,26,28,29)
InChI key:RKWZHFVZKOVXSK-UHFFFAOYSA-N
SMILES:CC1=C(C(=O)NC(=O)N1CC2=C(C=CC=C2F)C(F)(F)F)C3=C(C(=CC=C3)OC)F
Synonyms:
  • 5-(2-fluoro-3-methoxy-phenyl)-1-(2-fluoro-6-trifluoromethyl-benzyl)-6-methyl-1H-pyrimidine-2,4-dione
  • 5-(2-fluoro-3-methoxyphenyl)-1-(2-fluoro-6-(trifluoromethyl)benzyl)-6-methylpyrimidine-2,4(1H,3H)-dione
Found 6 products.