CymitQuimica logo

CAS 1150561-72-0

:

4-(3-(4,4,5,5-TetraMethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)Morpholine

Description:
4-(3-(4,4,5,5-TetraMethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)Morpholine is a chemical compound characterized by its complex structure, which includes a morpholine ring, a pyridine moiety, and a dioxaborolane group. The presence of the dioxaborolane unit suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions and as a reagent in organic synthesis. The tetra-methyl substitution on the dioxaborolane enhances its stability and solubility in organic solvents. Morpholine, a six-membered heterocyclic compound containing both nitrogen and oxygen, contributes to the compound's basicity and potential reactivity. The pyridine ring adds aromatic character and can participate in various chemical interactions. Overall, this compound may exhibit interesting properties such as solubility in polar organic solvents, moderate to high stability under standard conditions, and potential utility in medicinal chemistry or materials science due to its unique functional groups. Further studies would be necessary to fully elucidate its reactivity and applications.
Formula:C15H23BN2O3
InChI:InChI=1S/C15H23BN2O3/c1-14(2)15(3,4)21-16(20-14)12-6-5-7-17-13(12)18-8-10-19-11-9-18/h5-7H,8-11H2,1-4H3
InChI key:JLCDXVWUDXAGHB-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=C(N=CC=C2)N3CCOCC3
Found 3 products.