CAS 1150561-73-1

1-[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine

Description:

1-[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine is a chemical compound characterized by its complex structure, which includes a piperazine ring and a pyridine moiety substituted with a boron-containing group. The presence of the 4,4,5,5-tetramethyl-1,3,2-dioxaborolane unit suggests that this compound may exhibit unique reactivity due to the boron atom, which can participate in various chemical transformations, including cross-coupling reactions. The compound is likely to be a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the piperazine and pyridine functionalities that are often associated with biological activity. Additionally, the dioxaborolane group may enhance solubility and stability in certain environments. As with many boron-containing compounds, it may also exhibit interesting properties in coordination chemistry and materials science. Safety data and handling precautions should be considered, as with all chemical substances.

Formula: C₁₅H₂₄BN₃O₂

InChI: InChI=1S/C15H24BN3O2/c1-14(2)15(3,4)21-16(20-14)12-6-5-7-18-13(12)19-10-8-17-9-11-19/h5-7,17H,8-11H2,1-4H3

InChI key: InChIKey=HQTJTIJSMLAMPK-UHFFFAOYSA-N

SMILES: CC1(C)OB(C2=C(N=CC=C2)N3CCNCC3)OC1(C)C

Synonyms:

• 1-[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine
• Piperazine, 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-

Piperazine, 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-

CAS: 1150561-73-1

Formula: C₁₅H₂₄BN₃O₂

Molecular weight: 289.1810

Ref: IN-DA000FSS