CAS 1150561-83-3
:5-Bromo-N-butyl-3-pyridinecarboxamide
Description:
5-Bromo-N-butyl-3-pyridinecarboxamide is a chemical compound characterized by its brominated pyridine structure, which contributes to its unique reactivity and potential biological activity. The presence of the bromine atom enhances the compound's electrophilicity, making it suitable for various chemical reactions, including nucleophilic substitutions. The butyl group provides hydrophobic characteristics, influencing the compound's solubility and interaction with biological membranes. As a carboxamide, it features a carbonyl group adjacent to a nitrogen atom, which can participate in hydrogen bonding, affecting its physical properties and biological interactions. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific applications and effects would depend on further studies, including its mechanism of action and potential therapeutic uses. Overall, 5-Bromo-N-butyl-3-pyridinecarboxamide represents a versatile structure with implications in both synthetic and medicinal chemistry.
Formula:C10H13BrN2O
InChI:InChI=1S/C10H13BrN2O/c1-2-3-4-13-10(14)8-5-9(11)7-12-6-8/h5-7H,2-4H2,1H3,(H,13,14)
InChI key:InChIKey=JYLRBVKAUPICND-UHFFFAOYSA-N
SMILES:C(NCCCC)(=O)C=1C=C(Br)C=NC1
Synonyms:- 5-Bromo-N-butyl-3-pyridinecarboxamide
- 3-Pyridinecarboxamide, 5-bromo-N-butyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
