CymitQuimica logo

CAS 1150566-27-0

:

ethyl 6-chloroimidazo[1,2-b]pyridazine-3-carboxylate

Description:
Ethyl 6-chloroimidazo[1,2-b]pyridazine-3-carboxylate is a chemical compound characterized by its unique structure, which includes an imidazo[1,2-b]pyridazine core, a chloro substituent, and an ethyl ester functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the chloro group may influence its reactivity and interactions with biological targets, making it of interest in medicinal chemistry. Ethyl esters generally have moderate polarity, which can affect their pharmacokinetic properties. The compound may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, due to the presence of reactive functional groups. Its specific applications and biological activities would depend on further studies, including pharmacological evaluations and structure-activity relationship analyses. Overall, ethyl 6-chloroimidazo[1,2-b]pyridazine-3-carboxylate represents a class of compounds that could be explored for potential therapeutic uses.
Formula:C9H8ClN3O2
InChI:InChI=1S/C9H8ClN3O2/c1-2-15-9(14)6-5-11-8-4-3-7(10)12-13(6)8/h3-5H,2H2,1H3
InChI key:AVYSSBABIUPEMY-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CN=C2N1N=C(C=C2)Cl
Synonyms:
  • Ethyl 6-Chloroimidazo[1,2-B]Pyridazine-3-Ncarboxylate
  • Imidazo[1,2-b]pyridazine-3-carboxylic acid,6-chloro-,ethyl ester
  • 6-Chloro-Imidazo[1,2-B]Pyridazine-3-Carboxylic Acid Ethyl Ester
Found 4 products.