
CAS 115058-21-4
:2-Naphthalenesulfonic acid, 6,6′-(carbonyldiimino)bis-
Description:
2-Naphthalenesulfonic acid, 6,6′-(carbonyldiimino)bis- is an organic compound characterized by its complex structure, which includes a naphthalene ring system and sulfonic acid functional groups. This compound features a bis-carbonyldiimino moiety, indicating the presence of two imine groups linked to a carbonyl group, which contributes to its reactivity and potential applications in various chemical processes. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the sulfonic acid group. The presence of the naphthalene structure suggests potential applications in dye chemistry, as naphthalene derivatives are often used in the synthesis of dyes and pigments. Additionally, the sulfonic acid group can enhance the compound's solubility and reactivity, making it useful in various industrial applications, including as a reagent or catalyst in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C21H16N2O7S2
InChI:InChI=1S/C21H16N2O7S2/c24-21(22-17-5-1-15-11-19(31(25,26)27)7-3-13(15)9-17)23-18-6-2-16-12-20(32(28,29)30)8-4-14(16)10-18/h1-12H,(H2,22,23,24)(H,25,26,27)(H,28,29,30)
InChI key:InChIKey=YIGGIAXHUTUTPG-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=CC2=C(C=C(NC(NC3=CC4=C(C=C3)C=C(S(=O)(=O)O)C=C4)=O)C=C2)C=C1
Synonyms:- 2-Naphthalenesulfonic acid, 6,6′-(carbonyldiimino)bis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Naphthalenesulfonic acid, 6,6'-(carbonyldiimino)bis- (9CI)
CAS:Formula:C21H16N2O7S2Molecular weight:472.4909
