CAS 115060-15-6

phenyl-(2-difluoroethyl)-4-aminopropylamidinohydrazone

Description:

Phenyl-(2-difluoroethyl)-4-aminopropylamidinohydrazone, identified by its CAS number 115060-15-6, is a chemical compound characterized by its complex structure, which includes a phenyl group, a difluoroethyl moiety, and an amidinohydrazone functional group. This compound typically exhibits properties associated with hydrazones, such as potential reactivity with carbonyl compounds and the ability to form stable complexes. The presence of the difluoroethyl group may impart unique electronic and steric properties, influencing its reactivity and interaction with biological systems. Additionally, the amidinohydrazone structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. The compound's solubility, stability, and specific reactivity would depend on the surrounding conditions, including pH and solvent polarity. Overall, phenyl-(2-difluoroethyl)-4-aminopropylamidinohydrazone represents a compound of interest for further research in both synthetic and applied chemistry contexts.

Formula: C₁₂H₁₇F₂N₅

InChI: InChI=1/C12H17F2N5/c13-11(14)10(9-5-2-1-3-6-9)18-19-12(16)17-8-4-7-15/h1-3,5-6,11H,4,7-8,15H2,(H3,16,17,19)/b18-10+

Synonyms:

• Difluorophenylethyl(4-aminopropylamidinohydrazone)
• Hydrazinecarboximidamide, N-(3-aminopropyl)-2-(2,2-difluoro-1-phenylethylidene)-
• (2E)-N'-(3-aminopropyl)-2-(2,2-difluoro-1-phenylethylidene)hydrazinecarboximidamide
• Phenyl-(2-difluoroethyl)-4-aminopropylamidinohydrazone