
CAS 1150617-59-6
:5-[1-(4-Fluorophenyl)cyclopropyl]-2H-tetrazole
Description:
5-[1-(4-Fluorophenyl)cyclopropyl]-2H-tetrazole is a chemical compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. The presence of the cyclopropyl group and the 4-fluorophenyl substituent contributes to its unique properties, potentially influencing its reactivity and biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The fluorine atom in the phenyl ring can enhance lipophilicity and metabolic stability, while the tetrazole moiety is known for its ability to form hydrogen bonds, which can be crucial for interactions with biological targets. Additionally, the compound's molecular structure suggests potential applications in drug development, particularly in areas such as anti-inflammatory or anti-cancer therapies. Its specific characteristics, including solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups in a given formulation.
Formula:C10H9FN4
InChI:InChI=1S/C10H9FN4/c11-8-3-1-7(2-4-8)10(5-6-10)9-12-14-15-13-9/h1-4H,5-6H2,(H,12,13,14,15)
InChI key:InChIKey=ZCENUBCKCODCEJ-UHFFFAOYSA-N
SMILES:FC1=CC=C(C2(CC2)C=3NN=NN3)C=C1
Synonyms:- 2H-Tetrazole, 5-[1-(4-fluorophenyl)cyclopropyl]-
- 5-[1-(4-Fluorophenyl)cyclopropyl]-2H-tetrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.