CAS 1150617-69-8
:1,2,3,4-Tetrahydro-2,4-dioxo-8-quinazolinecarbonitrile
Description:
1,2,3,4-Tetrahydro-2,4-dioxo-8-quinazolinecarbonitrile is a heterocyclic organic compound characterized by its quinazoline structure, which features a fused bicyclic system. This compound contains a tetrahydro framework, indicating the presence of a saturated ring, along with two carbonyl (dioxo) groups that contribute to its reactivity and potential biological activity. The carbonitrile functional group enhances its chemical properties, making it a candidate for various applications in medicinal chemistry. The presence of multiple functional groups suggests that it may exhibit diverse pharmacological activities, including potential anti-inflammatory or anticancer properties. Its molecular structure allows for interactions with biological targets, which is of interest in drug development. Additionally, the compound's stability and solubility characteristics can influence its bioavailability and efficacy in therapeutic contexts. Overall, 1,2,3,4-Tetrahydro-2,4-dioxo-8-quinazolinecarbonitrile represents a significant compound for further research in the field of medicinal chemistry and drug discovery.
Formula:C9H5N3O2
InChI:InChI=1S/C9H5N3O2/c10-4-5-2-1-3-6-7(5)11-9(14)12-8(6)13/h1-3H,(H2,11,12,13,14)
InChI key:InChIKey=UKJMAOKCTWBIBZ-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(C(=O)NC(=O)N2)=CC=C1
Synonyms:- 8-Quinazolinecarbonitrile, 1,2,3,4-tetrahydro-2,4-dioxo-
- 1,2,3,4-Tetrahydro-2,4-dioxo-8-quinazolinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
