
CAS 1150617-91-6
:2-(2-Pyrrolidinyl)-3-pyridinol
Description:
2-(2-Pyrrolidinyl)-3-pyridinol, identified by its CAS number 1150617-91-6, is a chemical compound that features a pyridine ring substituted with a pyrrolidine moiety. This compound exhibits characteristics typical of heterocyclic compounds, including potential basicity due to the nitrogen atoms present in both the pyridine and pyrrolidine rings. The presence of the hydroxyl group on the pyridine ring contributes to its potential as a hydrogen bond donor, influencing its solubility and reactivity. The structural arrangement suggests that it may participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The specific properties, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which they are measured. Overall, 2-(2-Pyrrolidinyl)-3-pyridinol represents a versatile structure with potential applications in various fields of chemistry and pharmacology.
Formula:C9H12N2O
InChI:InChI=1S/C9H12N2O/c12-8-4-2-6-11-9(8)7-3-1-5-10-7/h2,4,6-7,10,12H,1,3,5H2
InChI key:InChIKey=FOSVDLDCLWVSDM-UHFFFAOYSA-N
SMILES:OC1=C(C2CCCN2)N=CC=C1
Synonyms:- 2-(2-Pyrrolidinyl)-3-pyridinol
- 3-Pyridinol, 2-(2-pyrrolidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.