CAS 1150618-10-2
:5-Fluoro-2-(methoxymethyl)-4(3H)-pyrimidinone
Description:
5-Fluoro-2-(methoxymethyl)-4(3H)-pyrimidinone is a pyrimidine derivative characterized by the presence of a fluorine atom at the 5-position and a methoxymethyl group at the 2-position of the pyrimidine ring. This compound features a heterocyclic structure, which is common in many pharmaceuticals and biologically active molecules. The methoxymethyl group contributes to its solubility and reactivity, while the fluorine atom can enhance the compound's metabolic stability and lipophilicity. Typically, such compounds exhibit a range of biological activities, making them of interest in medicinal chemistry. The presence of the pyrimidinone moiety suggests potential applications in nucleoside analogs or as inhibitors in various biochemical pathways. Its molecular properties, including melting point, solubility, and reactivity, would be influenced by the functional groups attached to the pyrimidine ring. Overall, 5-Fluoro-2-(methoxymethyl)-4(3H)-pyrimidinone represents a structurally intriguing compound with potential implications in drug development and therapeutic applications.
Formula:C6H7FN2O2
InChI:InChI=1S/C6H7FN2O2/c1-11-3-5-8-2-4(7)6(10)9-5/h2H,3H2,1H3,(H,8,9,10)
InChI key:InChIKey=AUVNQKRSIVTLIL-UHFFFAOYSA-N
SMILES:C(OC)C=1NC(=O)C(F)=CN1
Synonyms:- 5-Fluoro-2-(methoxymethyl)-4(3H)-pyrimidinone
- 4(3H)-Pyrimidinone, 5-fluoro-2-(methoxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
