CAS 1150618-11-3

N4-Cyclopropyl-2,4-pyrimidinediamine

Description:

N4-Cyclopropyl-2,4-pyrimidinediamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 2 and 4 positions. The presence of a cyclopropyl group at the N4 position contributes to its unique properties, potentially influencing its biological activity and reactivity. This compound is typically classified as a diamine due to the presence of two amine functional groups, which can participate in hydrogen bonding and other interactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many nitrogen-containing heterocycles, it may exhibit interesting electronic properties and could be involved in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₇H₁₀N₄

InChI: InChI=1S/C7H10N4/c8-7-9-4-3-6(11-7)10-5-1-2-5/h3-5H,1-2H2,(H3,8,9,10,11)

InChI key: InChIKey=JGVKLXCMCLUJPB-UHFFFAOYSA-N

SMILES: N(C1CC1)C2=NC(N)=NC=C2

Synonyms:

• N4-Cyclopropyl-2,4-pyrimidinediamine
• N4-Cyclopropylpyrimidine-2,4-diamine
• 2,4-Pyrimidinediamine, N4-cyclopropyl-