CAS 1150618-16-8

2-Bromo-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid

Description:

2-Bromo-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and a pyridine ring. The presence of a bromine atom at the 2-position and a carboxylic acid functional group at the 5-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its molecular structure allows for various chemical modifications, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. The compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Additionally, its biological activity may be influenced by the bromine substituent, which can affect interactions with biological targets. Overall, 2-Bromo-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid is of interest for further research in organic synthesis and drug development.

Formula: C₈H₅BrN₂O₂

InChI: InChI=1S/C8H5BrN2O2/c9-6-2-4-1-5(8(12)13)3-10-7(4)11-6/h1-3H,(H,10,11)(H,12,13)

InChI key: InChIKey=ZGRCZTRTKKEOOV-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C2C(=NC1)NC(Br)=C2

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid, 2-bromo-
• 2-Bromo-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid

1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid, 2-bromo-

CAS: 1150618-16-8

Formula: C₈H₅BrN₂O₂

Molecular weight: 241.0415

Ref: IN-DA000FUC