CAS 1150618-23-7

1-(3-Bromo-6-quinolinyl)ethanone

Description:

1-(3-Bromo-6-quinolinyl)ethanone is an organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the heterocyclic ring. The presence of a bromine atom at the 3-position of the quinoline ring contributes to its reactivity and potential applications in medicinal chemistry. The ethanone functional group indicates that the compound contains a carbonyl group (C=O) adjacent to an ethyl group, which can influence its chemical behavior, including its ability to participate in nucleophilic reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can affect its solubility and stability. Additionally, the bromine substituent can enhance lipophilicity, potentially influencing the compound's pharmacokinetic properties. Overall, 1-(3-Bromo-6-quinolinyl)ethanone represents a versatile scaffold for further chemical modifications and investigations in drug development.

Formula: C₁₁H₈BrNO

InChI: InChI=1S/C11H8BrNO/c1-7(14)8-2-3-11-9(4-8)5-10(12)6-13-11/h2-6H,1H3

InChI key: InChIKey=AYEUSAZLYWJBOM-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=CC2=C(C=C1)N=CC(Br)=C2

Synonyms:

• Ethanone, 1-(3-bromo-6-quinolinyl)-
• 1-(3-Bromo-6-quinolinyl)ethanone

Ethanone, 1-(3-bromo-6-quinolinyl)-

CAS: 1150618-23-7

Formula: C₁₁H₈BrNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 250.0913

Ref: IN-DA000FU5

1-(3-Bromoquinolin-6-yl)ethan-1-one

CAS: 1150618-23-7

1-(3-Bromoquinolin-6-yl)ethan-1-one

Purity: 98%

Molecular weight: 250.09g/mol

Ref: 54-OR90679

1-(3-Bromoquinolin-6-yl)ethanone

CAS: 1150618-23-7

Formula: C₁₁H₈BrNO

Purity: 98%

Molecular weight: 250.095

Ref: 10-F237970