
CAS 1150618-24-8
:3-Bromo-α-methyl-6-quinolinemethanamine
Description:
3-Bromo-α-methyl-6-quinolinemethanamine is a chemical compound characterized by its unique structure, which includes a quinoline ring system substituted with a bromine atom and an amino group. This compound typically exhibits properties associated with both aromatic and aliphatic amines, such as potential basicity due to the presence of the amino group. The bromine substitution can influence its reactivity, making it a candidate for various chemical transformations, including nucleophilic substitutions. The presence of the quinoline moiety suggests potential biological activity, as many quinoline derivatives are known for their pharmacological properties. Additionally, the α-methyl group may affect the steric hindrance and overall molecular conformation, which can further influence its interactions in biological systems. As with many organic compounds, the solubility, stability, and reactivity of 3-Bromo-α-methyl-6-quinolinemethanamine can vary depending on the solvent and environmental conditions. Overall, this compound may have applications in medicinal chemistry and materials science, warranting further investigation into its properties and potential uses.
Formula:C11H11BrN2
InChI:InChI=1S/C11H11BrN2/c1-7(13)8-2-3-11-9(4-8)5-10(12)6-14-11/h2-7H,13H2,1H3
InChI key:InChIKey=RBSRHKUMFVBXDC-UHFFFAOYSA-N
SMILES:C(C)(N)C1=CC2=C(C=C1)N=CC(Br)=C2
Synonyms:- 3-Bromo-α-methyl-6-quinolinemethanamine
- 6-Quinolinemethanamine, 3-bromo-α-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
