CymitQuimica logo

CAS 1150618-38-4

:

5-(2-Aminoethyl)-2-piperidinone

Description:
5-(2-Aminoethyl)-2-piperidinone is a chemical compound characterized by its piperidinone structure, which features a piperidine ring with a ketone and an aminoethyl substituent. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the amino group that can engage in hydrogen bonding. It has potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to act as a building block for various bioactive molecules. The presence of both an amino group and a carbonyl group in its structure suggests that it may participate in various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, the compound's properties may be influenced by factors such as pH and temperature, which can affect its ionization state and reactivity. Overall, 5-(2-Aminoethyl)-2-piperidinone is of interest in research and development within the fields of organic and medicinal chemistry.
Formula:C7H14N2O
InChI:InChI=1S/C7H14N2O/c8-4-3-6-1-2-7(10)9-5-6/h6H,1-5,8H2,(H,9,10)
InChI key:InChIKey=NMMFAIILCICRRY-UHFFFAOYSA-N
SMILES:C(CN)C1CCC(=O)NC1
Synonyms:
  • 5-(2-Aminoethyl)-2-piperidinone
  • 2-Piperidinone, 5-(2-aminoethyl)-
  • 5-(2-aMinoethyl)piperidin-2-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.