CAS 1150618-46-4
:3-Iodo-6-methoxy-2H-indazole
Description:
3-Iodo-6-methoxy-2H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of an iodine atom at the 3-position and a methoxy group at the 6-position contributes to its unique reactivity and potential biological activity. This compound is typically classified as a heterocyclic aromatic compound, which may exhibit interesting properties due to the electron-withdrawing nature of the iodine atom and the electron-donating characteristics of the methoxy group. Such substitutions can influence the compound's solubility, stability, and interaction with biological targets. 3-Iodo-6-methoxy-2H-indazole may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as indazole derivatives have been explored for various therapeutic applications, including anti-inflammatory and anticancer activities. However, specific data regarding its physical properties, reactivity, and biological effects would require further investigation through experimental studies.
Formula:C8H7IN2O
InChI:InChI=1S/C8H7IN2O/c1-12-5-2-3-6-7(4-5)10-11-8(6)9/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=OHXDNTHWTHMKRG-UHFFFAOYSA-N
SMILES:IC1=C2C(C=C(OC)C=C2)=NN1
Synonyms:- 3-Iodo-6-methoxy-2H-indazole
- 2H-Indazole, 3-iodo-6-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
