
CAS 1150618-47-5
:3-Iodo-6-methoxy-2-methyl-2H-indazole
Description:
3-Iodo-6-methoxy-2-methyl-2H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of an iodine atom at the 3-position and a methoxy group at the 6-position contributes to its unique reactivity and potential applications in medicinal chemistry. The methyl group at the 2-position further modifies its electronic properties and steric hindrance. This compound may exhibit interesting biological activities, making it a subject of interest in drug discovery and development. Its molecular structure suggests potential interactions with biological targets, which could lead to therapeutic applications. Additionally, the presence of halogen and methoxy substituents can influence its solubility, stability, and overall pharmacokinetic properties. As with many indazole derivatives, the compound may also be investigated for its role in various chemical reactions, including those involving nucleophilic substitutions or coupling reactions. Overall, 3-Iodo-6-methoxy-2-methyl-2H-indazole represents a versatile scaffold in organic synthesis and pharmaceutical research.
Formula:C9H9IN2O
InChI:InChI=1S/C9H9IN2O/c1-12-9(10)7-4-3-6(13-2)5-8(7)11-12/h3-5H,1-2H3
InChI key:InChIKey=QJRJZDWBCPFRAN-UHFFFAOYSA-N
SMILES:IC1=C2C(C=C(OC)C=C2)=NN1C
Synonyms:- 3-Iodo-6-methoxy-2-methyl-2H-indazole
- 2H-Indazole, 3-iodo-6-methoxy-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.