CAS 1150618-48-6

Methyl 6-methoxy-2-methyl-2H-indazole-3-carboxylate

Description:

Methyl 6-methoxy-2-methyl-2H-indazole-3-carboxylate is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. This compound features a methoxy group (-OCH3) and a carboxylate ester functional group, contributing to its chemical reactivity and potential applications in medicinal chemistry. The presence of the methyl groups enhances its lipophilicity, which may influence its biological activity and solubility. As an indazole derivative, it may exhibit interesting pharmacological properties, making it a subject of interest in drug discovery and development. The compound's molecular structure suggests potential interactions with biological targets, which could be explored in various therapeutic contexts. However, specific data regarding its toxicity, stability, and detailed biological activity would require further investigation through experimental studies. Overall, Methyl 6-methoxy-2-methyl-2H-indazole-3-carboxylate represents a unique structure within the realm of organic chemistry and pharmacology.

Formula: C₁₁H₁₂N₂O₃

InChI: InChI=1S/C11H12N2O3/c1-13-10(11(14)16-3)8-5-4-7(15-2)6-9(8)12-13/h4-6H,1-3H3

InChI key: InChIKey=UWDSVCGWCGJJRK-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(=NN1C)C=C(OC)C=C2

Synonyms:

• 2H-Indazole-3-carboxylic acid, 6-methoxy-2-methyl-, methyl ester
• Methyl 6-methoxy-2-methyl-2H-indazole-3-carboxylate