
CAS 1150618-49-7
:6-Methoxy-2-methyl-2H-indazole-3-carboxylic acid
Description:
6-Methoxy-2-methyl-2H-indazole-3-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a methoxy group at the 6-position and a carboxylic acid functional group at the 3-position contributes to its chemical reactivity and solubility properties. This compound is typically a white to off-white solid and is soluble in polar solvents, which may facilitate its use in various chemical reactions and applications. The methyl group at the 2-position enhances its lipophilicity, potentially influencing its biological activity. As a carboxylic acid, it can participate in acid-base reactions and form salts or esters. The compound may be of interest in medicinal chemistry and pharmacology due to its structural features, which could impart specific biological activities. However, detailed studies on its pharmacokinetics, toxicity, and therapeutic potential would be necessary to fully understand its applications.
Formula:C10H10N2O3
InChI:InChI=1S/C10H10N2O3/c1-12-9(10(13)14)7-4-3-6(15-2)5-8(7)11-12/h3-5H,1-2H3,(H,13,14)
InChI key:InChIKey=SDAIJPHWYJMLMV-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(=NN1C)C=C(OC)C=C2
Synonyms:- 6-Methoxy-2-methyl-2H-indazole-3-carboxylic acid
- 2H-Indazole-3-carboxylic acid, 6-methoxy-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.