CAS 115063-92-8

Thieno[3,2-b]pyridin-6-amine (9CI)

Description:

Thieno[3,2-b]pyridin-6-amine, with the CAS number 115063-92-8, is a heterocyclic organic compound characterized by the presence of both a thieno and a pyridine ring structure. This compound features a nitrogen atom in the pyridine ring and an amino group (-NH2) at the 6-position of the thieno-pyridine framework. It is typically a solid at room temperature and may exhibit properties such as moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. Thieno[3,2-b]pyridin-6-amine is of interest in medicinal chemistry and drug development, as it may serve as a scaffold for the synthesis of bioactive compounds. Its unique structural features can influence its biological activity, making it a candidate for various pharmacological applications. Additionally, the compound's reactivity can be attributed to the functional groups present, allowing for further chemical modifications. Overall, thieno[3,2-b]pyridin-6-amine represents a versatile structure in organic synthesis and pharmaceutical research.

Formula: C₇H₆N₂S

InChI: InChI=1/C7H6N2S/c8-5-3-7-6(9-4-5)1-2-10-7/h1-4H,8H2

SMILES: c1csc2cc(cnc12)N

Synonyms:

• Thieno[3,2-B]Pyridin-6-Amine

Thieno[3,2-b]pyridin-6-amine

CAS: 115063-92-8

Formula: C₇H₆N₂S

Molecular weight: 150.2009

Ref: IN-DA000FUF