CAS 115066-03-0
:1,8-diethyl-1-methyl-1,3,4,9-tetrahydropyrano[3,4-b]indole
Description:
1,8-Diethyl-1-methyl-1,3,4,9-tetrahydropyrano[3,4-b]indole is a complex organic compound characterized by its unique bicyclic structure, which incorporates both indole and tetrahydropyran moieties. This compound features multiple ethyl and methyl substituents, contributing to its hydrophobic nature and potentially influencing its solubility in organic solvents. The presence of the tetrahydropyran ring suggests that it may exhibit interesting chemical reactivity, particularly in nucleophilic or electrophilic reactions. Additionally, the indole structure is known for its biological significance, often serving as a core structure in various natural products and pharmaceuticals. The compound's specific properties, such as melting point, boiling point, and spectral characteristics (NMR, IR, MS), would be essential for identifying and characterizing it in laboratory settings. Its potential applications could span medicinal chemistry, where derivatives of indole are frequently explored for their pharmacological activities. However, detailed studies would be necessary to fully understand its reactivity, stability, and biological interactions.
Formula:C16H21NO
InChI:InChI=1/C16H21NO/c1-4-11-7-6-8-12-13-9-10-18-16(3,5-2)15(13)17-14(11)12/h6-8,17H,4-5,9-10H2,1-3H3
SMILES:CCc1cccc2c3CCOC(C)(CC)c3[nH]c12
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Etodolac EP Impurity J
CAS:Controlled ProductFormula:C16H21NOColor and Shape:NeatMolecular weight:243.34Decarboxy Etodolac
CAS:Controlled ProductImpurity Etodolac EP Impurity J
Applications Decarboxy Etodolac (Etodolac EP Impurity J) is an impurity of Etodolac (racemic, E933100), which is a non-steroidal anti-inflammatory drug (NSAID) that selectively inhibits cyclooxygenase-2 (COX-2). Etodolac displays anti-inflammatory effects in both adjuvant arthritic and normal rats. Etodolac is anti-inflammatory.
References Humber, L.G., et al.: Med. Res. Rev., 7, 1 (1987); Balfour, J.A, et al.: Drugs, 42, 274 (1991); Kato, et al.: J. Pharm. Pharmacol., 53 1679 (2001)Formula:C16H21NOColor and Shape:White To YellowMolecular weight:243.341,8-Diethyl-1,3,4,9-tetrahydro-1-methylpyrano[3,4-b]indole
CAS:1,8-Diethyl-1,3,4,9-tetrahydro-1-methylpyrano[3,4-b]indole is an acidic compound that has oral formulations. It is racemic and cholesteryl. It also binds to indole-1-acetic acid. This compound has not been studied extensively in humans or animals.Formula:C16H21NOPurity:Min. 95%Molecular weight:243.34 g/mol




