CAS 115070-62-7
:7-(CHLOROMETHYL)-2,2-DIMETHYL-2,3-DIHYDRO-1-BENZOFURAN
Description:
7-(Chloromethyl)-2,2-dimethyl-2,3-dihydro-1-benzofuran, identified by its CAS number 115070-62-7, is an organic compound characterized by its unique structural features, which include a benzofuran core and a chloromethyl substituent. This compound typically exhibits a molecular structure that combines a fused benzene and furan ring, contributing to its aromatic properties. The presence of the chloromethyl group suggests potential reactivity, particularly in nucleophilic substitution reactions. The dimethyl groups enhance its steric bulk, which can influence its reactivity and interactions with other molecules. This compound may be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its potential biological activity. Additionally, its physical properties, such as solubility and boiling point, would depend on the specific conditions and the presence of functional groups. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C11H13ClO
InChI:InChI=1/C11H13ClO/c1-11(2)6-8-4-3-5-9(7-12)10(8)13-11/h3-5H,6-7H2,1-2H3
SMILES:CC1(C)Cc2cccc(CCl)c2O1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
