CAS 115093-90-8

4,5-Dichloro-7H-pyrrolo[2,3-d]pyrimidine

Description:

4,5-Dichloro-7H-pyrrolo[2,3-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings, which contribute to its unique chemical properties. This compound features two chlorine substituents at the 4 and 5 positions of the pyrrole ring, enhancing its reactivity and potential applications in medicinal chemistry. It is typically a solid at room temperature and exhibits moderate solubility in organic solvents. The presence of the dichloro groups can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, this compound has garnered interest in the field of pharmaceuticals due to its potential biological activity, particularly in the development of novel therapeutic agents. Its molecular structure allows for interactions with biological targets, which can be explored in drug discovery processes. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks.

Formula: C₆H₃Cl₂N₃

InChI: InChI=1/C6H3Cl2N3/c7-3-1-9-6-4(3)5(8)10-2-11-6/h1-2H,(H,9,10,11)

SMILES: c1c(c2c(Cl)nc[nH]c2n1)Cl

Synonyms:

• 7H-pyrrolo[2,3-d]pyrimidine, 4,5-dichloro-

7H-Pyrrolo[2,3-d]pyrimidine, 4,5-dichloro-

CAS: 115093-90-8

Formula: C₆H₃Cl₂N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 188.0141

Ref: IN-DA000FW7

4,5-Dichloro-7H-pyrrolo[2,3-d]pyrimidine

CAS: 115093-90-8

4,5-Dichloro-7H-pyrrolo[2,3-d]pyrimidine

Formula: C₆H₃Cl₂N₃

Purity: 95%

Color and Shape: white to off-white solid

Molecular weight: 188.01g/mol

Ref: 54-OR303357

4,5-Dichloro-7H-pyrrolo[2,3-d]pyrimidine

CAS: 115093-90-8

Formula: C₆H₃Cl₂N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 188.01

Ref: 10-F076217