CAS 1151-04-8
:2-(2-methoxybenzoyl)benzoic acid
Description:
2-(2-Methoxybenzoyl)benzoic acid, with the CAS number 1151-04-8, is an organic compound characterized by its aromatic structure and functional groups. It features a benzoic acid moiety, which contributes to its acidity, and a methoxybenzoyl group that enhances its aromatic properties. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents, such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic rings. The presence of the methoxy group can influence its reactivity and interaction with other substances, making it of interest in various chemical applications, including pharmaceuticals and materials science. Additionally, its structure may allow for potential applications in photochemistry or as a UV filter due to the presence of conjugated systems. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C15H12O4
InChI:InChI=1/C15H12O4/c1-19-13-9-5-4-8-12(13)14(16)10-6-2-3-7-11(10)15(17)18/h2-9H,1H3,(H,17,18)
SMILES:COc1ccccc1C(=O)c1ccccc1C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.