CAS 1151-97-9: 2-[(2,4-Dinitrophenyl)methyl]pyridine
Description:2-[(2,4-Dinitrophenyl)methyl]pyridine, with the CAS number 1151-97-9, is an organic compound characterized by its pyridine ring substituted with a 2,4-dinitrophenylmethyl group. This compound typically appears as a yellow crystalline solid due to the presence of the dinitrophenyl moiety, which is known for its strong electron-withdrawing properties. The presence of the pyridine ring contributes to its basicity and potential reactivity in various chemical reactions, including nucleophilic substitutions. It is often used in research and analytical chemistry, particularly in the synthesis of other organic compounds and as a reagent in various chemical assays. The dinitrophenyl group can also serve as a chromophore, making the compound useful in spectroscopic applications. However, due to the presence of nitro groups, it may exhibit toxicity and environmental hazards, necessitating careful handling and disposal. Overall, this compound is significant in both synthetic organic chemistry and analytical applications.
Formula:C12H9N3O4
InChI:InChI=1S/C12H9N3O4/c16-14(17)11-5-4-9(12(8-11)15(18)19)7-10-3-1-2-6-13-10/h1-6,8H,7H2
InChI key:InChIKey=KKFNJVINGIUTIH-UHFFFAOYSA-N
SMILES:O=N(=O)C1=CC=C(C(=C1)N(=O)=O)CC2=NC=CC=C2
- Synonyms:
- 2-(2,4-Dinitrobenzyl)Pyridine
- Pyridine, 2-((2,4-dinitrophenyl)methyl)-
- Pyridine, 2-(2,4-dinitrobenzyl)-
- 2-[(2,4-Dinitrophenyl)methyl]pyridine
- 2-((2,4-Dinitrophenyl)methyl)pyridine

2-(2,4-Dinitrobenzyl)pyridine
Ref: 3B-D1095
1g | 29.00 € | ||
5g | 72.00 € |

Pyridine, 2-[(2,4-dinitrophenyl)methyl]-
Ref: IN-DA000FWG
1g | 60.00 € | ||
250mg | 34.00 € |

Ref: 10-F607926
1g | To inquire | ||
250mg | To inquire |

2-(2,4-Dinitrobenzyl)pyridine
Ref: 3D-BAA15197
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information |