CAS 115104-25-1

2-(Bromomethyl)-7-chloroquinoline

Description:

2-(Bromomethyl)-7-chloroquinoline is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features a bromomethyl group (-CH2Br) and a chlorine atom (-Cl) attached to the quinoline ring, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of halogen substituents can enhance the compound's electrophilic properties, making it useful in various chemical reactions, such as nucleophilic substitutions. Additionally, the compound may exhibit biological activity, which is common among halogenated quinolines, potentially serving as a scaffold for the development of pharmaceuticals. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. As with many halogenated compounds, safety precautions should be taken when handling 2-(Bromomethyl)-7-chloroquinoline due to its potential toxicity and environmental impact.

Formula: C₁₀H₇BrClN

InChI: InChI=1S/C10H7BrClN/c11-6-9-4-2-7-1-3-8(12)5-10(7)13-9/h1-5H,6H2

InChI key: InChIKey=WJOPLBNTJYROCF-UHFFFAOYSA-N

SMILES: C(Br)C1=NC2=C(C=C1)C=CC(Cl)=C2

Synonyms:

• Quinoline, 2-(bromomethyl)-7-chloro-
• 2-(Bromomethyl)-7-chloroquinoline

Quinoline, 2-(bromomethyl)-7-chloro-

CAS: 115104-25-1

Formula: C₁₀H₇BrClN

Purity: 95%

Color and Shape: Solid

Molecular weight: 256.5263

Ref: IN-DA000GAU

2-(Bromomethyl)-7-chloroquinoline

CAS: 115104-25-1

2-(Bromomethyl)-7-chloroquinoline

Purity: 98%

Molecular weight: 256.53g/mol

Ref: 54-OR1060191

2-(Bromomethyl)-7-chloroquinoline

CAS: 115104-25-1

2-(Bromomethyl)-7-chloroquinoline is an anti-inflammatory agent that inhibits the production of prostaglandins. It has been shown to inhibit 6-hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid (TETRA), which is a precursor for prostaglandin synthesis. Studies have also shown that 2-(bromomethyl)-7-chloroquinoline has antiinflammatory activity and can be used for the treatment of inflammation. This drug has shown significant inhibition against many different proinflammatory pathways in cell cultures.

Formula: C₁₀H₇BrClN

Purity: Min. 95%

Molecular weight: 256.53 g/mol

Ref: 3D-QEA10425