
CAS 1151240-89-9
:Ethyl 3-amino-4-(2,4,5-trifluorophenyl)-2-butenoate
Description:
Ethyl 3-amino-4-(2,4,5-trifluorophenyl)-2-butenoate is an organic compound characterized by its unique structure, which includes an ethyl ester group, an amino group, and a trifluorophenyl substituent. This compound features a butenoate backbone, indicating the presence of a double bond and a carboxylic acid derivative. The trifluorophenyl group contributes to its potential reactivity and lipophilicity, making it of interest in medicinal chemistry and material science. The amino group can participate in hydrogen bonding and may influence the compound's solubility and biological activity. The presence of trifluoromethyl groups often enhances the metabolic stability of compounds, making them more resistant to degradation. Ethyl 3-amino-4-(2,4,5-trifluorophenyl)-2-butenoate may exhibit interesting pharmacological properties, potentially acting as a building block for the synthesis of more complex molecules. Its specific applications and behavior would depend on further studies, including its reactivity, stability, and interactions with biological systems.
Formula:C12H12F3NO2
InChI:InChI=1S/C12H12F3NO2/c1-2-18-12(17)5-8(16)3-7-4-10(14)11(15)6-9(7)13/h4-6H,2-3,16H2,1H3
InChI key:InChIKey=SFBGUVPIIJRHFD-UHFFFAOYSA-N
SMILES:C(C(=CC(OCC)=O)N)C1=C(F)C=C(F)C(F)=C1
Synonyms:- 2-Butenoic acid, 3-amino-4-(2,4,5-trifluorophenyl)-, ethyl ester
- Ethyl 3-amino-4-(2,4,5-trifluorophenyl)-2-butenoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Butenoic acid, 3-amino-4-(2,4,5-trifluorophenyl)-, ethyl ester
CAS:Formula:C12H12F3NO2Molecular weight:259.2244
