CymitQuimica logo

CAS 115132-19-9

:

(2R,3R)-2-[(tert-butoxycarbonyl)amino]-3-phenylbutanoate

Description:
The chemical substance known as (2R,3R)-2-[(tert-butoxycarbonyl)amino]-3-phenylbutanoate, with the CAS number 115132-19-9, is an amino acid derivative characterized by the presence of a tert-butoxycarbonyl (Boc) protecting group on the amino functional group. This compound features a chiral center, which contributes to its stereochemistry, specifically the (2R,3R) configuration. The phenyl group attached to the butanoate backbone enhances its hydrophobic characteristics, making it more lipophilic. The tert-butoxycarbonyl group is commonly used in organic synthesis as a protective group for amines, facilitating the selective functionalization of other reactive sites in the molecule. This compound is often utilized in peptide synthesis and medicinal chemistry due to its ability to serve as a building block for more complex structures. Its stability under various conditions, along with its solubility in organic solvents, makes it a valuable intermediate in synthetic pathways. Overall, this substance exemplifies the interplay between structural features and functional applications in organic and medicinal chemistry.
Formula:C15H20NO4
InChI:InChI=1/C15H21NO4/c1-10(11-8-6-5-7-9-11)12(13(17)18)16-14(19)20-15(2,3)4/h5-10,12H,1-4H3,(H,16,19)(H,17,18)/p-1/t10-,12-/m1/s1
SMILES:C[C@H](c1ccccc1)[C@H](C(=O)[O-])N=C(O)OC(C)(C)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.