CAS 115136-53-3
:azane: 6-methyl-2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyrid ine-3-carboxylic acid
Description:
The chemical substance known as azane: 6-methyl-2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylic acid, with the CAS number 115136-53-3, is a complex organic compound featuring a pyridine ring substituted with a carboxylic acid group and an imidazole moiety. This compound exhibits characteristics typical of heterocyclic compounds, including potential biological activity due to the presence of nitrogen-containing rings. The imidazole and pyridine structures suggest that it may participate in hydrogen bonding and coordination with metal ions, which can influence its reactivity and solubility. The presence of multiple functional groups, such as the carboxylic acid and ketone, indicates that it may engage in various chemical reactions, including esterification and nucleophilic attacks. Additionally, the methyl and isopropyl substituents can affect the compound's steric properties and overall stability. Such compounds are often of interest in medicinal chemistry and drug development due to their potential pharmacological properties.
Formula:C14H20N4O3
InChI:InChI=1/C14H17N3O3.H3N/c1-7(2)14(4)13(20)16-11(17-14)10-9(12(18)19)6-5-8(3)15-10;/h5-7H,1-4H3,(H,18,19)(H,16,17,20);1H3
SMILES:CC(C)C1(C)C(=O)N=C(c2c(ccc(C)n2)C(=O)O)N1.N
Synonyms:- Imazapic-ammonium [ISO]
- 2-(4,5-Dihydro-4-methyl-4-isopropyl-5-oxo-1H-imidazol-2-yl)-5-methyl-3-pyridinecarboxylic acid monoammonium salt
- 3-Pyridinecarboxylic acid, 2-(4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl)-5-methyl-, monoammonium salt
- 6-methyl-2-[4-methyl-4-(1-methylethyl)-5-oxo-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid ammoniate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.