CAS 115149-46-7

2-[3-(1,3-DIOXO-1,3-DIHYDRO-ISOINDOL-2-YL)-PROPOXY]-BENZOIC ACID METHYL ESTER

Description:

2-[3-(1,3-Dioxo-1,3-dihydro-isoindol-2-yl)-propoxy]-benzoic acid methyl ester, with CAS number 115149-46-7, is a synthetic organic compound characterized by its complex structure that includes an isoindole moiety and a benzoic acid derivative. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many esters and aromatic compounds. It may display biological activity due to the presence of the isoindole structure, which is known for its potential pharmacological properties. The methyl ester functional group suggests that it can undergo hydrolysis to release the corresponding benzoic acid, which may influence its reactivity and stability. Additionally, the compound's molecular structure may allow for interactions with various biological targets, making it of interest in medicinal chemistry. Overall, its characteristics make it a candidate for further research in drug development and other applications in organic synthesis.

Formula: C₁₉H₁₇NO₅

InChI: InChI=1/C19H17NO5/c1-24-19(23)15-9-4-5-10-16(15)25-12-6-11-20-17(21)13-7-2-3-8-14(13)18(20)22/h2-5,7-10H,6,11-12H2,1H3

SMILES: COC(=O)c1ccccc1OCCCN1C(=O)c2ccccc2C1=O

Synonyms:

• Methyl 2-(3-Phthalimidopropoxy)Benzoate
• Methyl 2-[3-(1,3-Dioxoisoindolin-2-Yl)Propoxy]Benzoate

Methyl 2-(3-(1,3-dioxoisoindolin-2-yl)propoxy)benzoate

CAS: 115149-46-7

Formula: C₁₉H₁₇NO₅

Molecular weight: 339.3420

Ref: IN-DA000GC3