CymitQuimica logo

CAS 1151512-25-2

:

4-bromothieno[2,3-c]pyridine-2-carboxylic acid

Description:
4-Bromothieno[2,3-c]pyridine-2-carboxylic acid is a heterocyclic organic compound characterized by the presence of a bromine atom, a thieno ring, and a pyridine structure. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity in various chemical reactions. The thieno and pyridine rings provide unique electronic properties, making it of interest in medicinal chemistry and material science. The presence of the bromine atom can enhance the compound's reactivity, allowing for further functionalization or substitution reactions. Additionally, the compound's structural features may influence its solubility, stability, and interaction with biological targets. As a result, 4-bromothieno[2,3-c]pyridine-2-carboxylic acid may be explored for applications in drug development, agrochemicals, or as a building block in organic synthesis. Its specific properties, such as melting point, boiling point, and spectral data, would require experimental determination or reference to scientific literature for precise characterization.
Formula:C8H4BrNO2S
InChI:InChI=1S/C8H4BrNO2S/c9-5-2-10-3-7-4(5)1-6(13-7)8(11)12/h1-3H,(H,11,12)
InChI key:InChIKey=BGKJZKJDJZNFMI-UHFFFAOYSA-N
SMILES:BrC1=C2C(SC(C(O)=O)=C2)=CN=C1
Found 5 products.