CAS 1151540-28-1: S-(-)-Cefotaxime

Description:S-(-)-Cefotaxime is a broad-spectrum cephalosporin antibiotic that is primarily used to treat bacterial infections. It exhibits a beta-lactam structure, which is characteristic of cephalosporins, allowing it to inhibit bacterial cell wall synthesis. This compound is particularly effective against a variety of Gram-positive and Gram-negative bacteria, making it a valuable option in clinical settings. S-(-)-Cefotaxime is known for its stability against certain beta-lactamases, enzymes produced by bacteria that can inactivate many antibiotics. The substance is typically administered via injection and has a relatively short half-life, necessitating multiple doses for effective treatment. Its pharmacokinetics involve rapid absorption and distribution in body tissues, with renal excretion being the primary route of elimination. Side effects may include allergic reactions, gastrointestinal disturbances, and potential impacts on renal function. Overall, S-(-)-Cefotaxime is an important therapeutic agent in the management of infections, particularly in hospital settings where resistant strains may be prevalent.

Formula:C₁₆H₁₇N₅O₇S₂

InChI:InChI=1S/C16H17N5O7S2/c1-6(22)28-3-7-4-29-14-10(13(24)21(14)11(7)15(25)26)19-12(23)9(20-27-2)8-5-30-16(17)18-8/h5,10,14H,3-4H2,1-2H3,(H2,17,18)(H,19,23)(H,25,26)/b20-9-/t10-,14-/m0/s1

InChI key:InChIKey=GPRBEKHLDVQUJE-CPAGPLPBSA-N

SMILES:O=C(O)C1=C(COC(=O)C)CSC2N1C(=O)C2NC(=O)C(=NOC)C=3N=C(SC3)N

Synonyms:
S-(-)-Cefotaxime
5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 3-[(acetyloxy)methyl]-7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(methoxyimino)acetyl]amino]-8-oxo-, (6S,7S)-
(6S,7S)-3-[(Acetyloxy)methyl]-7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(methoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid