CAS 115160-16-2
:1,5-dimethyl-2-phenyl-4-(quinazolin-4-ylamino)-1,2-dihydro-3H-pyrazol-3-one hydrochloride (1:1)
Description:
1,5-Dimethyl-2-phenyl-4-(quinazolin-4-ylamino)-1,2-dihydro-3H-pyrazol-3-one hydrochloride is a synthetic organic compound characterized by its complex structure, which includes a pyrazolone core, a quinazoline moiety, and multiple methyl and phenyl substituents. This compound typically exhibits properties such as solubility in polar solvents, which is common for hydrochloride salts, and may demonstrate biological activity due to its structural features, potentially influencing various biochemical pathways. The presence of the quinazoline and pyrazolone rings suggests potential pharmacological applications, possibly in the fields of anti-inflammatory or anticancer research. Its molecular interactions may involve hydrogen bonding and π-π stacking due to the aromatic systems present. As a hydrochloride salt, it is likely to be more stable and easier to handle compared to its free base form. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require experimental determination or detailed literature references for precise characterization.
Formula:C19H18ClN5O
InChI:InChI=1/C19H17N5O.ClH/c1-13-17(19(25)24(23(13)2)14-8-4-3-5-9-14)22-18-15-10-6-7-11-16(15)20-12-21-18;/h3-12H,1-2H3,(H,20,21,22);1H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3H-Pyrazol-3-one,1,2-dihydro-1,5-dimethyl-2-phenyl-4-(4-quinazolinylamino)-, hydrochloride (1:?)
CAS:Formula:C19H18ClN5OMolecular weight:367.8321
