CAS 115174-39-5
:METHYL 2-AMINO-5-PHENYL-1,3-THIAZOLE-4-CARBOXYLATE
Description:
Methyl 2-amino-5-phenyl-1,3-thiazole-4-carboxylate, with the CAS number 115174-39-5, is a chemical compound characterized by its thiazole ring structure, which incorporates both sulfur and nitrogen atoms. This compound features an amino group and a carboxylate ester, contributing to its potential reactivity and solubility in various solvents. The presence of a phenyl group enhances its aromatic characteristics, which may influence its biological activity and interactions. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The thiazole moiety is often associated with various biological activities, making this compound of interest in medicinal chemistry. Its molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which can affect its physical properties such as melting point, boiling point, and solubility. Overall, methyl 2-amino-5-phenyl-1,3-thiazole-4-carboxylate is a versatile compound with potential applications in various fields of chemistry and biology.
Formula:C11H10N2O2S
InChI:InChI=1/C11H10N2O2S/c1-15-10(14)8-9(16-11(12)13-8)7-5-3-2-4-6-7/h2-6H,1H3,(H2,12,13)
SMILES:COC(=O)c1c(c2ccccc2)sc(=N)[nH]1
Synonyms:- Iflab-Bb F2108-0172
- METHYL 2-AMINO-5-PHENYL-1,3-THIAZOLE-4-CARBOXYLATE
- Reaxys ID: 6019246
- Methyl 2-aMino-5-phenylthiazole-4-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Thiazolecarboxylic acid, 2-amino-5-phenyl-, methyl ester, hydrochloride (1:1)
CAS:Formula:C11H10N2O2SMolecular weight:234.2743
