CAS 1151767-59-7
:5-[(3,5-Difluorophenyl)methyl]-1,3,4-oxadiazol-2-amine
Description:
5-[(3,5-Difluorophenyl)methyl]-1,3,4-oxadiazol-2-amine is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of the 3,5-difluorophenyl group contributes to its unique properties, including potential biological activity and lipophilicity. This compound may exhibit various functional properties due to the electron-withdrawing effects of the fluorine atoms, which can influence its reactivity and interaction with biological targets. The amine functional group enhances its potential for hydrogen bonding, making it a candidate for various applications in medicinal chemistry and material science. Additionally, the compound's structure suggests it may have applications in pharmaceuticals, particularly in the development of new therapeutic agents. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups in a given formulation or reaction environment.
Formula:C9H7F2N3O
InChI:InChI=1S/C9H7F2N3O/c10-6-1-5(2-7(11)4-6)3-8-13-14-9(12)15-8/h1-2,4H,3H2,(H2,12,14)
InChI key:InChIKey=RWMWNQXLNITZPU-UHFFFAOYSA-N
SMILES:C(C=1OC(N)=NN1)C2=CC(F)=CC(F)=C2
Synonyms:- 5-[(3,5-Difluorophenyl)methyl]-1,3,4-oxadiazol-2-amine
- 1,3,4-Oxadiazol-2-amine, 5-[(3,5-difluorophenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.