
CAS 115177-60-1
:α-(2-Aminophenyl)-4-pyridinemethanol
Description:
α-(2-Aminophenyl)-4-pyridinemethanol, with the CAS number 115177-60-1, is a chemical compound characterized by its unique structural features, which include an amino group and a hydroxymethyl group attached to a pyridine ring. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The amino group contributes to its basicity and potential reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the presence of both aromatic and heterocyclic components in its structure may impart interesting electronic properties, influencing its behavior in biological systems or as a ligand in coordination chemistry. The compound's potential applications could span pharmaceuticals, where it may serve as a building block for drug development, or in materials science, depending on its reactivity and stability under different conditions. Overall, α-(2-Aminophenyl)-4-pyridinemethanol is a versatile compound with significant implications in various fields of chemistry.
Formula:C12H12N2O
InChI:InChI=1S/C12H12N2O/c13-11-4-2-1-3-10(11)12(15)9-5-7-14-8-6-9/h1-8,12,15H,13H2
InChI key:InChIKey=UPRNOIGBHHUETE-UHFFFAOYSA-N
SMILES:C(O)(C1=C(N)C=CC=C1)C=2C=CN=CC2
Synonyms:- α-(2-Aminophenyl)-4-pyridinemethanol
- 4-Pyridinemethanol, α-(2-aminophenyl)-
- (2-Aminophenyl)(pyridin-4-yl)methanol
- 2-Aminophenyl(4-pyridyl)methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.